C39H40N2O8 — CID 10462050
(3R,4S)-1-(4-methoxyphenyl)-4-[(4S,5S)-5-[(2S,3R)-1-(4-methoxyphenyl)-4-oxo-3-phenylmethoxyazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one (PubChem CID 10462050) has the molecular formula C39H40N2O8 and a molecular weight of 664.76 g/mol. Its IUPAC name is (3R,4S)-1-(4-methoxyphenyl)-4-[(4S,5S)-5-[(2S,3R)-1-(4-methoxyphenyl)-4-oxo-3-phenylmethoxyazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4S)-1-(4-methoxyphenyl)-4-[(4S,5S)-5-[(2S,3R)-1-(4-methoxyphenyl)-4-oxo-3-phenylmethoxyazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 10462050 |
| Molecular Formula | C39H40N2O8 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.28 |
| IUPAC Name | (3R,4S)-1-(4-methoxyphenyl)-4-[(4S,5S)-5-[(2S,3R)-1-(4-methoxyphenyl)-4-oxo-3-phenylmethoxyazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@H](OCc3ccccc3)[C@@H]2[C@@H]2OC(C)(C)O[C@H]2[C@H]2[C@@H](OCc3ccccc3)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H40N2O8/c1-39(2)48-33(31-35(46-23-25-11-7-5-8-12-25)37(42)40(31)27-15-19-29(44-3)20-16-27)34(49-39)32-36(47-24-26-13-9-6-10-14-26)38(43)41(32)28-17-21-30(45-4)22-18-28/h5-22,31-36H,23-24H2,1-4H3/t31-,32-,33-,34-,35+,36+/m0/s1 |
| InChIKey | GVNKRPSLLAIWGY-GFWDPPTMSA-N |
| XLogP | 5.53 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |