C18H18INO3 — CID 11452971
(3R,4R)-4-(iodomethyl)-1-(4-methoxyphenyl)-3-phenylmethoxyazetidin-2-one (PubChem CID 11452971) has the molecular formula C18H18INO3 and a molecular weight of 423.25 g/mol. Its IUPAC name is (3R,4R)-4-(iodomethyl)-1-(4-methoxyphenyl)-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4R)-4-(iodomethyl)-1-(4-methoxyphenyl)-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 11452971 |
| Molecular Formula | C18H18INO3 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | (3R,4R)-4-(iodomethyl)-1-(4-methoxyphenyl)-3-phenylmethoxyazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@H](OCc3ccccc3)[C@@H]2CI)cc1 |
| InChI | InChI=1S/C18H18INO3/c1-22-15-9-7-14(8-10-15)20-16(11-19)17(18(20)21)23-12-13-5-3-2-4-6-13/h2-10,16-17H,11-12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | AOTRSDBMSLCPDS-DLBZAZTESA-N |
| XLogP | 3.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|