C19H17NO3 — CID 15470886
(3S,4R)-4-ethynyl-1-(4-methoxyphenyl)-3-phenylmethoxyazetidin-2-one (PubChem CID 15470886) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3S,4R)-4-ethynyl-1-(4-methoxyphenyl)-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3S,4R)-4-ethynyl-1-(4-methoxyphenyl)-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 15470886 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3S,4R)-4-ethynyl-1-(4-methoxyphenyl)-3-phenylmethoxyazetidin-2-one |
| SMILES | C#C[C@@H]1[C@H](OCc2ccccc2)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-3-17-18(23-13-14-7-5-4-6-8-14)19(21)20(17)15-9-11-16(22-2)12-10-15/h1,4-12,17-18H,13H2,2H3/t17-,18+/m1/s1 |
| InChIKey | BDSSIQFBSCLZGD-MSOLQXFVSA-N |
| XLogP | 2.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|