C9H13ClO3 — CID 10774585
(3aR,4R,6R,6aR)-4-chloro-6-ethenyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 10774585) has the molecular formula C9H13ClO3 and a molecular weight of 204.65 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-4-chloro-6-ethenyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4R,6R,6aR)-4-chloro-6-ethenyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 10774585 |
| Molecular Formula | C9H13ClO3 |
| Molecular Weight | 204.65 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (3aR,4R,6R,6aR)-4-chloro-6-ethenyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | C=C[C@H]1O[C@H](Cl)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C9H13ClO3/c1-4-5-6-7(8(10)11-5)13-9(2,3)12-6/h4-8H,1H2,2-3H3/t5-,6-,7-,8+/m1/s1 |
| InChIKey | MEPJEGMUGIZLRS-XUTVFYLZSA-N |
| XLogP | 1.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.65 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|