C13H20O — CID 134894502
(3aR,6aS)-3a,6a-dimethyl-1-prop-2-enyl-3,4,5,6-tetrahydro-1H-pentalen-2-one (PubChem CID 134894502) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3aR,6aS)-3a,6a-dimethyl-1-prop-2-enyl-3,4,5,6-tetrahydro-1H-pentalen-2-one.
| Compound Name | (3aR,6aS)-3a,6a-dimethyl-1-prop-2-enyl-3,4,5,6-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 134894502 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3aR,6aS)-3a,6a-dimethyl-1-prop-2-enyl-3,4,5,6-tetrahydro-1H-pentalen-2-one |
| SMILES | C=CCC1C(=O)C[C@@]2(C)CCC[C@@]12C |
| InChI | InChI=1S/C13H20O/c1-4-6-10-11(14)9-12(2)7-5-8-13(10,12)3/h4,10H,1,5-9H2,2-3H3/t10?,12-,13+/m1/s1 |
| InChIKey | YJNCVSRWAZBIBR-SOYIIFOFSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|