C11H16O3 — CID 130847340
2-[(1S,2S)-2-ethenyl-2-methyl-6-oxocyclohexyl]acetic acid (PubChem CID 130847340) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-[(1S,2S)-2-ethenyl-2-methyl-6-oxocyclohexyl]acetic acid.
| Compound Name | 2-[(1S,2S)-2-ethenyl-2-methyl-6-oxocyclohexyl]acetic acid |
|---|---|
| PubChem CID | 130847340 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-[(1S,2S)-2-ethenyl-2-methyl-6-oxocyclohexyl]acetic acid |
| SMILES | C=C[C@]1(C)CCCC(=O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C11H16O3/c1-3-11(2)6-4-5-9(12)8(11)7-10(13)14/h3,8H,1,4-7H2,2H3,(H,13,14)/t8-,11-/m1/s1 |
| InChIKey | DTLMMUQYSGSDGS-LDYMZIIASA-N |
| XLogP | 2.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|