C11H18O2 — CID 130663138
2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]acetic acid (PubChem CID 130663138) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]acetic acid.
| Compound Name | 2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]acetic acid |
|---|---|
| PubChem CID | 130663138 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]acetic acid |
| SMILES | C=C1CCCC(C)(C)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C11H18O2/c1-8-5-4-6-11(2,3)9(8)7-10(12)13/h9H,1,4-7H2,2-3H3,(H,12,13)/t9-/m1/s1 |
| InChIKey | QMAONSMDNFCNMY-SECBINFHSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|