C19H28O5 — CID 16664238
[(E)-2-[(1S)-1-acetyloxy-2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-4-oxobut-2-enyl] acetate (PubChem CID 16664238) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is [(E)-2-[(1S)-1-acetyloxy-2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-4-oxobut-2-enyl] acetate.
| Compound Name | [(E)-2-[(1S)-1-acetyloxy-2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-4-oxobut-2-enyl] acetate |
|---|---|
| PubChem CID | 16664238 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | [(E)-2-[(1S)-1-acetyloxy-2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-4-oxobut-2-enyl] acetate |
| SMILES | C=C1CCCC(C)(C)[C@@H]1C[C@H](OC(C)=O)/C(=C/C=O)COC(C)=O |
| InChI | InChI=1S/C19H28O5/c1-13-7-6-9-19(4,5)17(13)11-18(24-15(3)22)16(8-10-20)12-23-14(2)21/h8,10,17-18H,1,6-7,9,11-12H2,2-5H3/b16-8+/t17-,18+/m1/s1 |
| InChIKey | BDJHWHPFANDUHR-NGLGELEOSA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|