C26H40O7 — CID 162967159
[(E,2S)-5-[(1R,2R,4aS,8aS)-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]-2-acetyloxy-3-(acetyloxymethyl)pent-3-enyl] acetate (PubChem CID 162967159) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(E,2S)-5-[(1R,2R,4aS,8aS)-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]-2-acetyloxy-3-(acetyloxymethyl)pent-3-enyl] acetate.
| Compound Name | [(E,2S)-5-[(1R,2R,4aS,8aS)-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]-2-acetyloxy-3-(acetyloxymethyl)pent-3-enyl] acetate |
|---|---|
| PubChem CID | 162967159 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(E,2S)-5-[(1R,2R,4aS,8aS)-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]-2-acetyloxy-3-(acetyloxymethyl)pent-3-enyl] acetate |
| SMILES | CC(=O)OC/C(=C\C[C@H]1[C@]2(CC[C@H]3C(C)(C)CCC[C@@]31C)CO2)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C26H40O7/c1-17(27)30-14-20(21(33-19(3)29)15-31-18(2)28)8-9-23-25(6)12-7-11-24(4,5)22(25)10-13-26(23)16-32-26/h8,21-23H,7,9-16H2,1-6H3/b20-8+/t21-,22+,23-,25+,26+/m1/s1 |
| InChIKey | UOTXGLUIIGURHP-SCQGWUMDSA-N |
| XLogP | 4.37 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|