C15H21Cl2NO5 — CID 3742392
methyl 4-[(2,4-dichloro-5,5-dimethoxy-3-oxo-4-prop-2-enylcyclopenten-1-yl)amino]butanoate (PubChem CID 3742392) has the molecular formula C15H21Cl2NO5 and a molecular weight of 366.24 g/mol. Its IUPAC name is methyl 4-[(2,4-dichloro-5,5-dimethoxy-3-oxo-4-prop-2-enylcyclopenten-1-yl)amino]butanoate.
| Compound Name | methyl 4-[(2,4-dichloro-5,5-dimethoxy-3-oxo-4-prop-2-enylcyclopenten-1-yl)amino]butanoate |
|---|---|
| PubChem CID | 3742392 |
| Molecular Formula | C15H21Cl2NO5 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | methyl 4-[(2,4-dichloro-5,5-dimethoxy-3-oxo-4-prop-2-enylcyclopenten-1-yl)amino]butanoate |
| SMILES | C=CCC1(Cl)C(=O)C(Cl)=C(NCCCC(=O)OC)C1(OC)OC |
| InChI | InChI=1S/C15H21Cl2NO5/c1-5-8-14(17)13(20)11(16)12(15(14,22-3)23-4)18-9-6-7-10(19)21-2/h5,18H,1,6-9H2,2-4H3 |
| InChIKey | CUXOALBLUZGGKR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|