C21H24Cl2O12 — CID 11663837
dimethyl (1S,2S,3S,4S,7S,8S,10S,11S)-1,4-dichloro-14,14,15,15-tetramethoxy-5,13-dioxo-6,12-dioxapentacyclo[9.2.1.14,7.02,10.03,8]pentadecane-7,11-dicarboxylate (PubChem CID 11663837) has the molecular formula C21H24Cl2O12 and a molecular weight of 539.32 g/mol. Its IUPAC name is dimethyl (1S,2S,3S,4S,7S,8S,10S,11S)-1,4-dichloro-14,14,15,15-tetramethoxy-5,13-dioxo-6,12-dioxapentacyclo[9.2.1.14,7.02,10.03,8]pentadecane-7,11-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3S,4S,7S,8S,10S,11S)-1,4-dichloro-14,14,15,15-tetramethoxy-5,13-dioxo-6,12-dioxapentacyclo[9.2.1.14,7.02,10.03,8]pentadecane-7,11-dicarboxylate |
|---|---|
| PubChem CID | 11663837 |
| Molecular Formula | C21H24Cl2O12 |
| Molecular Weight | 539.32 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | dimethyl (1S,2S,3S,4S,7S,8S,10S,11S)-1,4-dichloro-14,14,15,15-tetramethoxy-5,13-dioxo-6,12-dioxapentacyclo[9.2.1.14,7.02,10.03,8]pentadecane-7,11-dicarboxylate |
| SMILES | COC(=O)[C@]12OC(=O)[C@](Cl)([C@@H]3[C@@H]4[C@H](C[C@@H]31)[C@]1(C(=O)OC)OC(=O)[C@@]4(Cl)C1(OC)OC)C2(OC)OC |
| InChI | InChI=1S/C21H24Cl2O12/c1-28-14(26)18-8-7-9-11(10(8)16(22,12(24)34-18)20(18,30-3)31-4)17(23)13(25)35-19(9,15(27)29-2)21(17,32-5)33-6/h8-11H,7H2,1-6H3/t8-,9-,10-,11-,16+,17+,18+,19+/m0/s1 |
| InChIKey | ACNBETYNEGEPEU-IUVMNMOHSA-N |
| XLogP | -0.25 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|