C22H28O15 — CID 11656679
tetramethyl (1S,2S,3R,4R,6S,7S,9R,10R)-12,12,13,13-tetramethoxy-5,8,11-trioxapentacyclo[8.1.1.14,6.02,9.03,7]tridecane-1,4,6,10-tetracarboxylate (PubChem CID 11656679) has the molecular formula C22H28O15 and a molecular weight of 532.45 g/mol. Its IUPAC name is tetramethyl (1S,2S,3R,4R,6S,7S,9R,10R)-12,12,13,13-tetramethoxy-5,8,11-trioxapentacyclo[8.1.1.14,6.02,9.03,7]tridecane-1,4,6,10-tetracarboxylate.
| Compound Name | tetramethyl (1S,2S,3R,4R,6S,7S,9R,10R)-12,12,13,13-tetramethoxy-5,8,11-trioxapentacyclo[8.1.1.14,6.02,9.03,7]tridecane-1,4,6,10-tetracarboxylate |
|---|---|
| PubChem CID | 11656679 |
| Molecular Formula | C22H28O15 |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | tetramethyl (1S,2S,3R,4R,6S,7S,9R,10R)-12,12,13,13-tetramethoxy-5,8,11-trioxapentacyclo[8.1.1.14,6.02,9.03,7]tridecane-1,4,6,10-tetracarboxylate |
| SMILES | COC(=O)[C@@]12O[C@@](C(=O)OC)([C@H]3[C@@H]4[C@H](O[C@H]31)[C@]1(C(=O)OC)O[C@@]4(C(=O)OC)C1(OC)OC)C2(OC)OC |
| InChI | InChI=1S/C22H28O15/c1-27-13(23)17-9-10-12(35-11(9)19(36-17,15(25)29-3)21(17,31-5)32-6)20(16(26)30-4)22(33-7,34-8)18(10,37-20)14(24)28-2/h9-12H,1-8H3/t9-,10+,11+,12-,17+,18-,19-,20+ |
| InChIKey | ZSDODCGPOFZKMF-CSZSYISDSA-N |
| XLogP | -2.30 |
| TPSA | 169.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|