carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate

C10H15NO4 — CID 158127472

IUPACcarbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate
SMILESCOC(=O)C1(N)CC2CC1C2C.O=C=O
InChIInChI=1S/C9H15NO2.CO2/c1-5-6-3-7(5)9(10,4-6)8(11)12-2;2-1-3/h5-7H,3-4,10H2,1-2H3;
InChIKeyFSIZXYBEUHIYBN-UHFFFAOYSA-N
MW213.23 g/mol
LogP-0.05
Rot. Bonds1

About carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate

carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 158127472) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate.

Molecular Properties

Compound Namecarbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate
PubChem CID158127472
Molecular FormulaC10H15NO4
Molecular Weight213.23 g/mol
Exact Mass213.10
IUPAC Namecarbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate
SMILESCOC(=O)C1(N)CC2CC1C2C.O=C=O
InChIInChI=1S/C9H15NO2.CO2/c1-5-6-3-7(5)9(10,4-6)8(11)12-2;2-1-3/h5-7H,3-4,10H2,1-2H3;
InChIKeyFSIZXYBEUHIYBN-UHFFFAOYSA-N
XLogP-0.05
TPSA86.46 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.23
LogP ≤ 5-0.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate?
The IUPAC name of carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate (CID 158127472) is carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate.
What is the SMILES notation for carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate?
The canonical SMILES for carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate is COC(=O)C1(N)CC2CC1C2C.O=C=O.
What is the InChIKey of carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate?
The InChIKey is FSIZXYBEUHIYBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.CO2/c1-5-6-3-7(5)9(10,4-6)8(11)12-2;2-1-3/h5-7H,3-4,10H2,1-2H3;.
What are the key properties of carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate?
carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate has a molecular weight of 213.23 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate is sourced from PubChem (CID 158127472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).