C10H15NO4 — CID 158127472
carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 158127472) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate.
| Compound Name | carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate |
|---|---|
| PubChem CID | 158127472 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | carbon dioxide;methyl 2-amino-5-methylbicyclo[2.1.1]hexane-2-carboxylate |
| SMILES | COC(=O)C1(N)CC2CC1C2C.O=C=O |
| InChI | InChI=1S/C9H15NO2.CO2/c1-5-6-3-7(5)9(10,4-6)8(11)12-2;2-1-3/h5-7H,3-4,10H2,1-2H3; |
| InChIKey | FSIZXYBEUHIYBN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |