About dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate
dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 20715383) has the molecular formula C10H14FNO4
and a molecular weight of 231.22 g/mol. Its IUPAC name is dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate.
Analyze dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate?
The IUPAC name of dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate (CID 20715383) is dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate.
What is the SMILES notation for dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate?
The canonical SMILES for dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate is COC(=O)C1(N)CCC2C1C2(F)C(=O)OC.
What is the InChIKey of dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate?
The InChIKey is MWAOBWMFCHPEQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNO4/c1-15-7(13)9(12)4-3-5-6(9)10(5,11)8(14)16-2/h5-6H,3-4,12H2,1-2H3.
What are the key properties of dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate?
dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate has a molecular weight of 231.22 g/mol, XLogP of -0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-amino-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate is sourced from PubChem (CID 20715383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).