C11H14Cl2O6 — CID 101187294
methyl (1S,2R,4R,6R)-1,4-dichloro-6-hydroxy-7,7-dimethoxy-5-oxobicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 101187294) has the molecular formula C11H14Cl2O6 and a molecular weight of 313.13 g/mol. Its IUPAC name is methyl (1S,2R,4R,6R)-1,4-dichloro-6-hydroxy-7,7-dimethoxy-5-oxobicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,2R,4R,6R)-1,4-dichloro-6-hydroxy-7,7-dimethoxy-5-oxobicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 101187294 |
| Molecular Formula | C11H14Cl2O6 |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | methyl (1S,2R,4R,6R)-1,4-dichloro-6-hydroxy-7,7-dimethoxy-5-oxobicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]2(Cl)C(=O)[C@@H](O)[C@]1(Cl)C2(OC)OC |
| InChI | InChI=1S/C11H14Cl2O6/c1-17-8(16)5-4-9(12)6(14)7(15)10(5,13)11(9,18-2)19-3/h5,7,15H,4H2,1-3H3/t5-,7-,9-,10+/m1/s1 |
| InChIKey | RCVLZSRGCQRWRI-PXMQNUKVSA-N |
| XLogP | 0.07 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|