C10H14O2 — CID 124787312
(1R,3S,6S,8S)-4-oxatricyclo[4.3.1.13,8]undecan-2-one (PubChem CID 124787312) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,3S,6S,8S)-4-oxatricyclo[4.3.1.13,8]undecan-2-one.
| Compound Name | (1R,3S,6S,8S)-4-oxatricyclo[4.3.1.13,8]undecan-2-one |
|---|---|
| PubChem CID | 124787312 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1R,3S,6S,8S)-4-oxatricyclo[4.3.1.13,8]undecan-2-one |
| SMILES | O=C1[C@H]2C[C@H]3CO[C@H]1C[C@@H](C3)C2 |
| InChI | InChI=1S/C10H14O2/c11-10-8-2-6-1-7(3-8)5-12-9(10)4-6/h6-9H,1-5H2/t6-,7-,8+,9-/m0/s1 |
| InChIKey | ZSBJLFQMHJJYQT-MAUMQABQSA-N |
| XLogP | 1.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |