C10H13IO — CID 98536749
(1R,3S,4S,5R,7S)-4-iodoadamantan-2-one (PubChem CID 98536749) has the molecular formula C10H13IO and a molecular weight of 276.12 g/mol. Its IUPAC name is (1R,3S,4S,5R,7S)-4-iodoadamantan-2-one.
| Compound Name | (1R,3S,4S,5R,7S)-4-iodoadamantan-2-one |
|---|---|
| PubChem CID | 98536749 |
| Molecular Formula | C10H13IO |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | (1R,3S,4S,5R,7S)-4-iodoadamantan-2-one |
| SMILES | O=C1[C@@H]2C[C@H]3C[C@H](C2)[C@H](I)[C@H]1C3 |
| InChI | InChI=1S/C10H13IO/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-9H,1-4H2/t5-,6-,7-,8-,9+/m1/s1 |
| InChIKey | PLSIVLGZSAHBHL-OKNNCHMLSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|