C10H10ClNO2 — CID 102010476
4-chloro-10-oxo-2-oxatricyclo[4.3.1.03,8]decane-3-carbonitrile (PubChem CID 102010476) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 4-chloro-10-oxo-2-oxatricyclo[4.3.1.03,8]decane-3-carbonitrile.
| Compound Name | 4-chloro-10-oxo-2-oxatricyclo[4.3.1.03,8]decane-3-carbonitrile |
|---|---|
| PubChem CID | 102010476 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 4-chloro-10-oxo-2-oxatricyclo[4.3.1.03,8]decane-3-carbonitrile |
| SMILES | N#CC12OC3CC1CC(CC2Cl)C3=O |
| InChI | InChI=1S/C10H10ClNO2/c11-8-2-5-1-6-3-7(9(5)13)14-10(6,8)4-12/h5-8H,1-3H2 |
| InChIKey | WSRGPXREJJBXRF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|