About 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one
2,2-diethoxy-3,4-dihydroxycyclobutan-1-one (PubChem CID 118574697) has the molecular formula C8H14O5
and a molecular weight of 190.19 g/mol. Its IUPAC name is 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one.
Molecular Properties
| Compound Name | 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one |
| PubChem CID | 118574697 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one |
| SMILES | CCOC1(OCC)C(=O)C(O)C1O |
| InChI | InChI=1S/C8H14O5/c1-3-12-8(13-4-2)6(10)5(9)7(8)11/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | JUYOEXNKIWNATK-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one?
The IUPAC name of 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one (CID 118574697) is 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one.
What is the SMILES notation for 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one?
The canonical SMILES for 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one is CCOC1(OCC)C(=O)C(O)C1O.
What is the InChIKey of 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one?
The InChIKey is JUYOEXNKIWNATK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5/c1-3-12-8(13-4-2)6(10)5(9)7(8)11/h5-6,9-10H,3-4H2,1-2H3.
What are the key properties of 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one?
2,2-diethoxy-3,4-dihydroxycyclobutan-1-one has a molecular weight of 190.19 g/mol, XLogP of -0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxy-3,4-dihydroxycyclobutan-1-one is sourced from PubChem (CID 118574697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).