C10H15FO3S — CID 102391622
ethyl 5-fluoro-2,4,4-trimethyl-3-oxothiolane-2-carboxylate (PubChem CID 102391622) has the molecular formula C10H15FO3S and a molecular weight of 234.29 g/mol. Its IUPAC name is ethyl 5-fluoro-2,4,4-trimethyl-3-oxothiolane-2-carboxylate.
| Compound Name | ethyl 5-fluoro-2,4,4-trimethyl-3-oxothiolane-2-carboxylate |
|---|---|
| PubChem CID | 102391622 |
| Molecular Formula | C10H15FO3S |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | ethyl 5-fluoro-2,4,4-trimethyl-3-oxothiolane-2-carboxylate |
| SMILES | CCOC(=O)C1(C)SC(F)C(C)(C)C1=O |
| InChI | InChI=1S/C10H15FO3S/c1-5-14-8(13)10(4)6(12)9(2,3)7(11)15-10/h7H,5H2,1-4H3 |
| InChIKey | FDRGKJMWHBRKKP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|