About pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione
pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione (PubChem CID 78226067) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione.
Analyze pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione?
The IUPAC name of pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione (CID 78226067) is pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione.
What is the SMILES notation for pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione?
The canonical SMILES for pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione is O=C1C2CC3C4CC5CC(C(C2)C3C5=O)C14.
What is the InChIKey of pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione?
The InChIKey is TVSHIFVVJLCWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c15-13-5-1-7-8-3-6-4-10(12(8)13)9(2-5)11(7)14(6)16/h5-12H,1-4H2.
What are the key properties of pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione?
pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione has a molecular weight of 216.28 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3,10-dione is sourced from PubChem (CID 78226067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).