C11H11BrO — CID 99845185
(1S,2S,3R,5S,6R,7R,8S,9R,10R)-7-bromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-one (PubChem CID 99845185) has the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. Its IUPAC name is (1S,2S,3R,5S,6R,7R,8S,9R,10R)-7-bromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-one.
| Compound Name | (1S,2S,3R,5S,6R,7R,8S,9R,10R)-7-bromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-one |
|---|---|
| PubChem CID | 99845185 |
| Molecular Formula | C11H11BrO |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | (1S,2S,3R,5S,6R,7R,8S,9R,10R)-7-bromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-one |
| SMILES | O=C1[C@@H]2[C@@H]3C[C@@H]4[C@@H]5[C@@H](Br)[C@@H]([C@@H]1[C@@H]35)[C@@H]42 |
| InChI | InChI=1S/C11H11BrO/c12-10-6-2-1-3-4(6)9-8(10)5(2)7(3)11(9)13/h2-10H,1H2/t2-,3+,4-,5-,6-,7+,8+,9-,10+/m0/s1 |
| InChIKey | AMHCEXBDUDDEPZ-YJLRAPOFSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|