C7H8Br2 — CID 76763972
(2R,3S,5S,6S)-3,5-dibromotricyclo[2.2.1.02,6]heptane (PubChem CID 76763972) has the molecular formula C7H8Br2 and a molecular weight of 251.95 g/mol. Its IUPAC name is (2R,3S,5S,6S)-3,5-dibromotricyclo[2.2.1.02,6]heptane.
| Compound Name | (2R,3S,5S,6S)-3,5-dibromotricyclo[2.2.1.02,6]heptane |
|---|---|
| PubChem CID | 76763972 |
| Molecular Formula | C7H8Br2 |
| Molecular Weight | 251.95 g/mol |
| Exact Mass | 249.90 |
| IUPAC Name | (2R,3S,5S,6S)-3,5-dibromotricyclo[2.2.1.02,6]heptane |
| SMILES | Br[C@@H]1C2CC3[C@@H]1[C@H]3[C@@H]2Br |
| InChI | InChI=1S/C7H8Br2/c8-6-3-1-2-4(6)5(2)7(3)9/h2-7H,1H2/t2?,3?,4-,5+,6-,7-/m1/s1 |
| InChIKey | SYFIGJNFOVWPEX-LURNONNXSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.95 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|