About 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane
3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane (PubChem CID 17383272) has the molecular formula C13H12BrClO2S
and a molecular weight of 347.66 g/mol. Its IUPAC name is 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane.
Molecular Properties
| Compound Name | 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane |
| PubChem CID | 17383272 |
| Molecular Formula | C13H12BrClO2S |
| Molecular Weight | 347.66 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1C2CC3C(C2Br)C31 |
| InChI | InChI=1S/C13H12BrClO2S/c14-12-9-5-8-10(12)11(8)13(9)18(16,17)7-3-1-6(15)2-4-7/h1-4,8-13H,5H2 |
| InChIKey | YMDKYVIZIDDYNG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.66 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane?
The IUPAC name of 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane (CID 17383272) is 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane.
What is the SMILES notation for 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane?
The canonical SMILES for 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane is O=S(=O)(c1ccc(Cl)cc1)C1C2CC3C(C2Br)C31.
What is the InChIKey of 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane?
The InChIKey is YMDKYVIZIDDYNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrClO2S/c14-12-9-5-8-10(12)11(8)13(9)18(16,17)7-3-1-6(15)2-4-7/h1-4,8-13H,5H2.
What are the key properties of 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane?
3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane has a molecular weight of 347.66 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(4-chlorophenyl)sulfonyltricyclo[2.2.1.02,6]heptane is sourced from PubChem (CID 17383272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).