C16H26O2 — CID 13075074
1'-tert-butylspiro[1,3-dioxolane-2,4'-adamantane] (PubChem CID 13075074) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1'-tert-butylspiro[1,3-dioxolane-2,4'-adamantane].
| Compound Name | 1'-tert-butylspiro[1,3-dioxolane-2,4'-adamantane] |
|---|---|
| PubChem CID | 13075074 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1'-tert-butylspiro[1,3-dioxolane-2,4'-adamantane] |
| SMILES | CC(C)(C)C12CC3CC(C1)C1(OCCO1)C(C3)C2 |
| InChI | InChI=1S/C16H26O2/c1-14(2,3)15-8-11-6-12(9-15)16(13(7-11)10-15)17-4-5-18-16/h11-13H,4-10H2,1-3H3 |
| InChIKey | RDZXKRYKQYFLCY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |