C15H26O2 — CID 102096003
2,2-dicyclohexyl-1,3-dioxolane (PubChem CID 102096003) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2,2-dicyclohexyl-1,3-dioxolane.
| Compound Name | 2,2-dicyclohexyl-1,3-dioxolane |
|---|---|
| PubChem CID | 102096003 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2,2-dicyclohexyl-1,3-dioxolane |
| SMILES | C1CCC(C2(C3CCCCC3)OCCO2)CC1 |
| InChI | InChI=1S/C15H26O2/c1-3-7-13(8-4-1)15(16-11-12-17-15)14-9-5-2-6-10-14/h13-14H,1-12H2 |
| InChIKey | SVCRFPOLMUKGTH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |