C16H29INO3+ — CID 126960723
4-methyl-4-spiro[1,3-dioxolane-2,9'-bicyclo[3.3.1]nonane]-2'-ylmorpholin-4-ium;hydroiodide (PubChem CID 126960723) has the molecular formula C16H29INO3+ and a molecular weight of 410.32 g/mol. Its IUPAC name is 4-methyl-4-spiro[1,3-dioxolane-2,9'-bicyclo[3.3.1]nonane]-2'-ylmorpholin-4-ium;hydroiodide.
| Compound Name | 4-methyl-4-spiro[1,3-dioxolane-2,9'-bicyclo[3.3.1]nonane]-2'-ylmorpholin-4-ium;hydroiodide |
|---|---|
| PubChem CID | 126960723 |
| Molecular Formula | C16H29INO3+ |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 4-methyl-4-spiro[1,3-dioxolane-2,9'-bicyclo[3.3.1]nonane]-2'-ylmorpholin-4-ium;hydroiodide |
| SMILES | C[N+]1(C2CCC3CCCC2C32OCCO2)CCOCC1.I |
| InChI | InChI=1S/C16H28NO3.HI/c1-17(7-9-18-10-8-17)15-6-5-13-3-2-4-14(15)16(13)19-11-12-20-16;/h13-15H,2-12H2,1H3;1H/q+1; |
| InChIKey | LLUGIBVBHNWFSI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|