C6H14BrNO — CID 15549249
4,4-dimethylmorpholin-4-ium bromide (PubChem CID 15549249) has the molecular formula C6H14BrNO and a molecular weight of 196.09 g/mol. Its IUPAC name is 4,4-dimethylmorpholin-4-ium bromide.
| Compound Name | 4,4-dimethylmorpholin-4-ium bromide |
|---|---|
| PubChem CID | 15549249 |
| Molecular Formula | C6H14BrNO |
| Molecular Weight | 196.09 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 4,4-dimethylmorpholin-4-ium bromide |
| SMILES | C[N+]1(C)CCOCC1.[Br-] |
| InChI | InChI=1S/C6H14NO.BrH/c1-7(2)3-5-8-6-4-7;/h3-6H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KSSZOYAWVXPUEW-UHFFFAOYSA-M |
| XLogP | -2.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.09 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|