About 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-)
4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-) (PubChem CID 67484156) has the molecular formula C6H11NO4-2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-).
Molecular Properties
| Compound Name | 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-) |
| PubChem CID | 67484156 |
| Molecular Formula | C6H11NO4-2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-) |
| SMILES | C[N+]1(C(=O)[O-])CCOCC1.[O-2] |
| InChI | InChI=1S/C6H11NO3.O/c1-7(6(8)9)2-4-10-5-3-7;/h2-5H2,1H3;/q;-2 |
| InChIKey | SFOHNACCJPXFFI-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-)?
The IUPAC name of 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-) (CID 67484156) is 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-).
What is the SMILES notation for 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-)?
The canonical SMILES for 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-) is C[N+]1(C(=O)[O-])CCOCC1.[O-2].
What is the InChIKey of 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-)?
The InChIKey is SFOHNACCJPXFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3.O/c1-7(6(8)9)2-4-10-5-3-7;/h2-5H2,1H3;/q;-2.
What are the key properties of 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-)?
4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-) has a molecular weight of 161.16 g/mol, XLogP of -1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylmorpholin-4-ium-4-carboxylate;oxygen(2-) is sourced from PubChem (CID 67484156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).