C18H37NO8 — CID 118645449
3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate;4-(2-methoxyethyl)-4-methylmorpholin-4-ium (PubChem CID 118645449) has the molecular formula C18H37NO8 and a molecular weight of 395.49 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate;4-(2-methoxyethyl)-4-methylmorpholin-4-ium.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate;4-(2-methoxyethyl)-4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 118645449 |
| Molecular Formula | C18H37NO8 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate;4-(2-methoxyethyl)-4-methylmorpholin-4-ium |
| SMILES | COCCOCCOCCOCCC(=O)[O-].COCC[N+]1(C)CCOCC1 |
| InChI | InChI=1S/C10H20O6.C8H18NO2/c1-13-4-5-15-8-9-16-7-6-14-3-2-10(11)12;1-9(3-6-10-2)4-7-11-8-5-9/h2-9H2,1H3,(H,11,12);3-8H2,1-2H3/q;+1/p-1 |
| InChIKey | BMBAQPHRNJJVAR-UHFFFAOYSA-M |
| XLogP | -1.07 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|