C17H35NO7 — CID 118645555
4-(2-ethoxyethyl)-4-methylmorpholin-4-ium;3-[2-(2-methoxyethoxy)ethoxy]propanoate (PubChem CID 118645555) has the molecular formula C17H35NO7 and a molecular weight of 365.47 g/mol. Its IUPAC name is 4-(2-ethoxyethyl)-4-methylmorpholin-4-ium;3-[2-(2-methoxyethoxy)ethoxy]propanoate.
| Compound Name | 4-(2-ethoxyethyl)-4-methylmorpholin-4-ium;3-[2-(2-methoxyethoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 118645555 |
| Molecular Formula | C17H35NO7 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 4-(2-ethoxyethyl)-4-methylmorpholin-4-ium;3-[2-(2-methoxyethoxy)ethoxy]propanoate |
| SMILES | CCOCC[N+]1(C)CCOCC1.COCCOCCOCCC(=O)[O-] |
| InChI | InChI=1S/C9H20NO2.C8H16O5/c1-3-11-7-4-10(2)5-8-12-9-6-10;1-11-4-5-13-7-6-12-3-2-8(9)10/h3-9H2,1-2H3;2-7H2,1H3,(H,9,10)/q+1;/p-1 |
| InChIKey | PKBYSWJKTSNRPH-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|