C18H36N2O2+2 — CID 129425858
4-[2-[[(1R,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methoxy]ethyl]-4-methylmorpholin-4-ium (PubChem CID 129425858) has the molecular formula C18H36N2O2+2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 4-[2-[[(1R,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methoxy]ethyl]-4-methylmorpholin-4-ium.
| Compound Name | 4-[2-[[(1R,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methoxy]ethyl]-4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 129425858 |
| Molecular Formula | C18H36N2O2+2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 4-[2-[[(1R,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methoxy]ethyl]-4-methylmorpholin-4-ium |
| SMILES | C[N+]1(CCOC[C@@H]2CCC[N@+]3(C)CCCC[C@H]23)CCOCC1 |
| InChI | InChI=1S/C18H36N2O2/c1-19(10-13-21-14-11-19)12-15-22-16-17-6-5-9-20(2)8-4-3-7-18(17)20/h17-18H,3-16H2,1-2H3/q+2/t17-,18+,20-/m0/s1 |
| InChIKey | CDFJUUFTPWMARE-NSHGMRRFSA-N |
| XLogP | 1.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|