C19H38N2O2+2 — CID 7078936
4-[(2S)-2-[[(1R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methoxy]propyl]-4-methylmorpholin-4-ium (PubChem CID 7078936) has the molecular formula C19H38N2O2+2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 4-[(2S)-2-[[(1R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methoxy]propyl]-4-methylmorpholin-4-ium.
| Compound Name | 4-[(2S)-2-[[(1R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methoxy]propyl]-4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 7078936 |
| Molecular Formula | C19H38N2O2+2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | 4-[(2S)-2-[[(1R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methoxy]propyl]-4-methylmorpholin-4-ium |
| SMILES | C[C@@H](C[N+]1(C)CCOCC1)OC[C@@H]1CCC[N+]2(C)CCCC[C@@H]12 |
| InChI | InChI=1S/C19H38N2O2/c1-17(15-20(2)11-13-22-14-12-20)23-16-18-7-6-10-21(3)9-5-4-8-19(18)21/h17-19H,4-16H2,1-3H3/q+2/t17-,18-,19-,21?/m0/s1 |
| InChIKey | VNZYHBOMJJKSJY-FOTGFLGGSA-N |
| XLogP | 2.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|