C13H16O4 — CID 22709217
(2'-oxospiro[bicyclo[2.2.1]heptane-5,4'-oxolane]-2-yl) prop-2-enoate (PubChem CID 22709217) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2'-oxospiro[bicyclo[2.2.1]heptane-5,4'-oxolane]-2-yl) prop-2-enoate.
| Compound Name | (2'-oxospiro[bicyclo[2.2.1]heptane-5,4'-oxolane]-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 22709217 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (2'-oxospiro[bicyclo[2.2.1]heptane-5,4'-oxolane]-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC2CC1CC21COC(=O)C1 |
| InChI | InChI=1S/C13H16O4/c1-2-11(14)17-10-4-9-3-8(10)5-13(9)6-12(15)16-7-13/h2,8-10H,1,3-7H2 |
| InChIKey | KAMUNCKYECTJOQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|