C4H8N2O2 — CID 123435745
4,4-diaminooxolan-2-one (PubChem CID 123435745) has the molecular formula C4H8N2O2 and a molecular weight of 116.12 g/mol. Its IUPAC name is 4,4-diaminooxolan-2-one.
| Compound Name | 4,4-diaminooxolan-2-one |
|---|---|
| PubChem CID | 123435745 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 4,4-diaminooxolan-2-one |
| SMILES | NC1(N)COC(=O)C1 |
| InChI | InChI=1S/C4H8N2O2/c5-4(6)1-3(7)8-2-4/h1-2,5-6H2 |
| InChIKey | ZNEBVDRMTCJVQZ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|