C8H9NO5 — CID 59960018
1-(3-methyl-5-oxooxolan-3-yl)oxyazetidine-2,4-dione (PubChem CID 59960018) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is 1-(3-methyl-5-oxooxolan-3-yl)oxyazetidine-2,4-dione.
| Compound Name | 1-(3-methyl-5-oxooxolan-3-yl)oxyazetidine-2,4-dione |
|---|---|
| PubChem CID | 59960018 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 1-(3-methyl-5-oxooxolan-3-yl)oxyazetidine-2,4-dione |
| SMILES | CC1(ON2C(=O)CC2=O)COC(=O)C1 |
| InChI | InChI=1S/C8H9NO5/c1-8(3-7(12)13-4-8)14-9-5(10)2-6(9)11/h2-4H2,1H3 |
| InChIKey | XWNFWFDDOXTCKG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|