C13H16I2NO4- — CID 149172833
CID 149172833 (PubChem CID 149172833) has the molecular formula C13H16I2NO4- and a molecular weight of 504.08 g/mol.
| Compound Name | CID 149172833 |
|---|---|
| PubChem CID | 149172833 |
| Molecular Formula | C13H16I2NO4- |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 503.92 |
| IUPAC Name | — |
| SMILES | O=C1CC2(CO1)CC1CC(OC(=O)C(I)C3N[I-]3)C2C1 |
| InChI | InChI=1S/C13H16I2NO4/c14-10(11-15-16-11)12(18)20-8-2-6-1-7(8)13(3-6)4-9(17)19-5-13/h6-8,10-11,16H,1-5H2/q-1 |
| InChIKey | QRSHMNOXMPOYGL-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|