C24H34O4Ru — CID 163648316
(5'-methyl-2-oxospiro[oxolane-4,10'-tetracyclo[6.2.1.13,6.02,7]dodecane]-4'-yl) 2-propan-2-ylpentanoate;ruthenium(2+) (PubChem CID 163648316) has the molecular formula C24H34O4Ru and a molecular weight of 487.60 g/mol. Its IUPAC name is (5'-methyl-2-oxospiro[oxolane-4,10'-tetracyclo[6.2.1.13,6.02,7]dodecane]-4'-yl) 2-propan-2-ylpentanoate;ruthenium(2+).
| Compound Name | (5'-methyl-2-oxospiro[oxolane-4,10'-tetracyclo[6.2.1.13,6.02,7]dodecane]-4'-yl) 2-propan-2-ylpentanoate;ruthenium(2+) |
|---|---|
| PubChem CID | 163648316 |
| Molecular Formula | C24H34O4Ru |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (5'-methyl-2-oxospiro[oxolane-4,10'-tetracyclo[6.2.1.13,6.02,7]dodecane]-4'-yl) 2-propan-2-ylpentanoate;ruthenium(2+) |
| SMILES | C[CH-]C[C-](C(=O)OC1C(C)C2CC1C1C2C2CC1C1(COC(=O)C1)C2)C(C)C.[Ru+2] |
| InChI | InChI=1S/C24H34O4.Ru/c1-5-6-15(12(2)3)23(26)28-22-13(4)16-8-17(22)21-18-7-14(20(16)21)9-24(18)10-19(25)27-11-24;/h5,12-14,16-18,20-22H,6-11H2,1-4H3;/q-2;+2 |
| InChIKey | ROFYWZBZQSVDCH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|