C22H32O2 — CID 143331417
(3-ethyl-5'-methyl-4-methylidenespiro[cyclopentane-1,10'-tetracyclo[6.2.1.13,6.02,7]dodecane]-4'-yl) acetate (PubChem CID 143331417) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (3-ethyl-5'-methyl-4-methylidenespiro[cyclopentane-1,10'-tetracyclo[6.2.1.13,6.02,7]dodecane]-4'-yl) acetate.
| Compound Name | (3-ethyl-5'-methyl-4-methylidenespiro[cyclopentane-1,10'-tetracyclo[6.2.1.13,6.02,7]dodecane]-4'-yl) acetate |
|---|---|
| PubChem CID | 143331417 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (3-ethyl-5'-methyl-4-methylidenespiro[cyclopentane-1,10'-tetracyclo[6.2.1.13,6.02,7]dodecane]-4'-yl) acetate |
| SMILES | C=C1CC2(CC1CC)CC1CC2C2C3CC(C(C)C3OC(C)=O)C12 |
| InChI | InChI=1S/C22H32O2/c1-5-14-9-22(8-11(14)2)10-15-6-18(22)20-17-7-16(19(15)20)12(3)21(17)24-13(4)23/h12,14-21H,2,5-10H2,1,3-4H3 |
| InChIKey | JTFHDPAQXJNZOC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|