C20H29F3O3 — CID 59203947
1-ethoxyethyl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 59203947) has the molecular formula C20H29F3O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-ethoxyethyl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 1-ethoxyethyl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 59203947 |
| Molecular Formula | C20H29F3O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 1-ethoxyethyl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CCOC(C)OC(=O)C1(C(F)(F)F)CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C20H29F3O3/c1-5-25-11(4)26-18(24)19(20(21,22)23)8-12-6-15(19)17-14-7-13(16(12)17)9(2)10(14)3/h9-17H,5-8H2,1-4H3 |
| InChIKey | PZBGEDGGKVATOA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|