C22H31F11O2Si — CID 91307459
4,4-difluoro-5-(trifluoromethyl)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane;dimethoxy(dimethyl)silane (PubChem CID 91307459) has the molecular formula C22H31F11O2Si and a molecular weight of 564.55 g/mol. Its IUPAC name is 4,4-difluoro-5-(trifluoromethyl)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane;dimethoxy(dimethyl)silane.
| Compound Name | 4,4-difluoro-5-(trifluoromethyl)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane;dimethoxy(dimethyl)silane |
|---|---|
| PubChem CID | 91307459 |
| Molecular Formula | C22H31F11O2Si |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 4,4-difluoro-5-(trifluoromethyl)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane;dimethoxy(dimethyl)silane |
| SMILES | CC(CC1(C(F)(F)F)C2CC(C3C4CCC(C4)C32)C1(F)F)(C(F)(F)F)C(F)(F)F.CO[Si](C)(C)OC |
| InChI | InChI=1S/C18H19F11.C4H12O2Si/c1-13(16(21,22)23,17(24,25)26)6-14(18(27,28)29)9-5-10(15(14,19)20)12-8-3-2-7(4-8)11(9)12;1-5-7(3,4)6-2/h7-12H,2-6H2,1H3;1-4H3 |
| InChIKey | UDBSVERCRCPPIT-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|