C16H29F5O5Si — CID 90944536
1-[[1-(2-bicyclo[2.2.1]heptanyl)-2-fluoroethoxy]methoxy]-1,2,2,2-tetrafluoroethanol;dimethoxy(dimethyl)silane (PubChem CID 90944536) has the molecular formula C16H29F5O5Si and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-[[1-(2-bicyclo[2.2.1]heptanyl)-2-fluoroethoxy]methoxy]-1,2,2,2-tetrafluoroethanol;dimethoxy(dimethyl)silane.
| Compound Name | 1-[[1-(2-bicyclo[2.2.1]heptanyl)-2-fluoroethoxy]methoxy]-1,2,2,2-tetrafluoroethanol;dimethoxy(dimethyl)silane |
|---|---|
| PubChem CID | 90944536 |
| Molecular Formula | C16H29F5O5Si |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-[[1-(2-bicyclo[2.2.1]heptanyl)-2-fluoroethoxy]methoxy]-1,2,2,2-tetrafluoroethanol;dimethoxy(dimethyl)silane |
| SMILES | CO[Si](C)(C)OC.OC(F)(OCOC(CF)C1CC2CCC1C2)C(F)(F)F |
| InChI | InChI=1S/C12H17F5O3.C4H12O2Si/c13-5-10(9-4-7-1-2-8(9)3-7)19-6-20-12(17,18)11(14,15)16;1-5-7(3,4)6-2/h7-10,18H,1-6H2;1-4H3 |
| InChIKey | SBVZGIYVDCRPJH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|