C21H35F5O3Si — CID 91082671
1,2,2,2-tetrafluoro-1-[[2-fluoro-1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethoxy]methoxy]ethanol;tetramethylsilane (PubChem CID 91082671) has the molecular formula C21H35F5O3Si and a molecular weight of 458.58 g/mol. Its IUPAC name is 1,2,2,2-tetrafluoro-1-[[2-fluoro-1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethoxy]methoxy]ethanol;tetramethylsilane.
| Compound Name | 1,2,2,2-tetrafluoro-1-[[2-fluoro-1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethoxy]methoxy]ethanol;tetramethylsilane |
|---|---|
| PubChem CID | 91082671 |
| Molecular Formula | C21H35F5O3Si |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 1,2,2,2-tetrafluoro-1-[[2-fluoro-1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethoxy]methoxy]ethanol;tetramethylsilane |
| SMILES | C[Si](C)(C)C.OC(F)(OCOC(CF)C1CC2CC1C1C3CCC(C3)C21)C(F)(F)F |
| InChI | InChI=1S/C17H23F5O3.C4H12Si/c18-6-13(24-7-25-17(22,23)16(19,20)21)11-4-10-5-12(11)15-9-2-1-8(3-9)14(10)15;1-5(2,3)4/h8-15,23H,1-7H2;1-4H3 |
| InChIKey | QQWOPOLCFOPYMU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|