C16H20F6 — CID 89368912
4-(1,1,1,2,3,3-hexafluorobutan-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 89368912) has the molecular formula C16H20F6 and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3-hexafluorobutan-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4-(1,1,1,2,3,3-hexafluorobutan-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 89368912 |
| Molecular Formula | C16H20F6 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-(1,1,1,2,3,3-hexafluorobutan-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC(F)(F)C(F)(C1CC2CC1C1C3CCC(C3)C21)C(F)(F)F |
| InChI | InChI=1S/C16H20F6/c1-14(17,18)15(19,16(20,21)22)11-6-9-5-10(11)13-8-3-2-7(4-8)12(9)13/h7-13H,2-6H2,1H3 |
| InChIKey | SHDFUZDXXYLFOR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|