C18H24F12O3 — CID 58820936
2-[3-[2-(2-butan-2-yloxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58820936) has the molecular formula C18H24F12O3 and a molecular weight of 516.36 g/mol. Its IUPAC name is 2-[3-[2-(2-butan-2-yloxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-[2-(2-butan-2-yloxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58820936 |
| Molecular Formula | C18H24F12O3 |
| Molecular Weight | 516.36 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-[3-[2-(2-butan-2-yloxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)OCCOC(C1CCCC(C(O)(C(F)(F)F)C(F)(F)F)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H24F12O3/c1-3-10(2)32-7-8-33-14(17(25,26)27,18(28,29)30)12-6-4-5-11(9-12)13(31,15(19,20)21)16(22,23)24/h10-12,31H,3-9H2,1-2H3 |
| InChIKey | LSEPBGHDQSQCNJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.36 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|