C10H17F3O2 — CID 21252674
4-(1,1,1-trifluoro-2-methoxypropan-2-yl)cyclohexan-1-ol (PubChem CID 21252674) has the molecular formula C10H17F3O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-(1,1,1-trifluoro-2-methoxypropan-2-yl)cyclohexan-1-ol.
| Compound Name | 4-(1,1,1-trifluoro-2-methoxypropan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 21252674 |
| Molecular Formula | C10H17F3O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 4-(1,1,1-trifluoro-2-methoxypropan-2-yl)cyclohexan-1-ol |
| SMILES | COC(C)(C1CCC(O)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O2/c1-9(15-2,10(11,12)13)7-3-5-8(14)6-4-7/h7-8,14H,3-6H2,1-2H3 |
| InChIKey | RHWSVHWLVTXQJF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |