C20H28F12O3 — CID 21053311
2-[3-butan-2-yl-5-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 21053311) has the molecular formula C20H28F12O3 and a molecular weight of 544.42 g/mol. Its IUPAC name is 2-[3-butan-2-yl-5-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-butan-2-yl-5-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 21053311 |
| Molecular Formula | C20H28F12O3 |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 2-[3-butan-2-yl-5-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCOC(C)OC(C1CC(C(C)CC)CC(C(O)(C(F)(F)F)C(F)(F)F)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H28F12O3/c1-5-10(3)12-7-13(15(33,17(21,22)23)18(24,25)26)9-14(8-12)16(19(27,28)29,20(30,31)32)35-11(4)34-6-2/h10-14,33H,5-9H2,1-4H3 |
| InChIKey | GWVRTQWHTJUEOO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|