C16H20F12O4S — CID 20770008
[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] butane-2-sulfonate (PubChem CID 20770008) has the molecular formula C16H20F12O4S and a molecular weight of 536.38 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] butane-2-sulfonate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] butane-2-sulfonate |
|---|---|
| PubChem CID | 20770008 |
| Molecular Formula | C16H20F12O4S |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] butane-2-sulfonate |
| SMILES | CCC(C)S(=O)(=O)OC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H20F12O4S/c1-3-8(2)33(30,31)32-12(15(23,24)25,16(26,27)28)10-6-4-9(5-7-10)11(29,13(17,18)19)14(20,21)22/h8-10,29H,3-7H2,1-2H3 |
| InChIKey | AHHQRXONYVMLNL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|