C18H20F12O4 — CID 89187951
[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 3-methyl-2-methylidenebutanoate (PubChem CID 89187951) has the molecular formula C18H20F12O4 and a molecular weight of 528.33 g/mol. Its IUPAC name is [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 3-methyl-2-methylidenebutanoate.
| Compound Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 89187951 |
| Molecular Formula | C18H20F12O4 |
| Molecular Weight | 528.33 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC1CC(C(O)(C(F)(F)F)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1)C(C)C |
| InChI | InChI=1S/C18H20F12O4/c1-7(2)8(3)12(31)34-11-5-9(13(32,15(19,20)21)16(22,23)24)4-10(6-11)14(33,17(25,26)27)18(28,29)30/h7,9-11,32-33H,3-6H2,1-2H3 |
| InChIKey | MUARGNWAHWLQOD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|