C16H20F8O4 — CID 90167721
[3,5-bis(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate (PubChem CID 90167721) has the molecular formula C16H20F8O4 and a molecular weight of 428.32 g/mol. Its IUPAC name is [3,5-bis(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [3,5-bis(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90167721 |
| Molecular Formula | C16H20F8O4 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [3,5-bis(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(C(O)(CF)C(F)(F)F)CC(C(O)(CF)C(F)(F)F)C1 |
| InChI | InChI=1S/C16H20F8O4/c1-8(2)12(25)28-11-4-9(13(26,6-17)15(19,20)21)3-10(5-11)14(27,7-18)16(22,23)24/h9-11,26-27H,1,3-7H2,2H3 |
| InChIKey | DJALUOWNKLFACZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|